C23H40N2O2 — CID 156560479
(Z)-N-(3,3-dimethylbutyl)-N-ethyl-5,5-dimethyl-7-[prop-2-enoyl(prop-2-enyl)amino]hept-2-enamide (PubChem CID 156560479) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is (Z)-N-(3,3-dimethylbutyl)-N-ethyl-5,5-dimethyl-7-[prop-2-enoyl(prop-2-enyl)amino]hept-2-enamide.
| Compound Name | (Z)-N-(3,3-dimethylbutyl)-N-ethyl-5,5-dimethyl-7-[prop-2-enoyl(prop-2-enyl)amino]hept-2-enamide |
|---|---|
| PubChem CID | 156560479 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | (Z)-N-(3,3-dimethylbutyl)-N-ethyl-5,5-dimethyl-7-[prop-2-enoyl(prop-2-enyl)amino]hept-2-enamide |
| SMILES | C=CCN(CCC(C)(C)C/C=C\C(=O)N(CC)CCC(C)(C)C)C(=O)C=C |
| InChI | InChI=1S/C23H40N2O2/c1-9-17-25(20(26)10-2)19-16-23(7,8)14-12-13-21(27)24(11-3)18-15-22(4,5)6/h9-10,12-13H,1-2,11,14-19H2,3-8H3/b13-12- |
| InChIKey | KLLSENUPUPDFKE-SEYXRHQNSA-N |
| XLogP | 4.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|