C17H19N3O5 — CID 156560645
7-[hydroxy(methoxy)methyl]-3-methyl-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 156560645) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 7-[hydroxy(methoxy)methyl]-3-methyl-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[hydroxy(methoxy)methyl]-3-methyl-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 156560645 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 7-[hydroxy(methoxy)methyl]-3-methyl-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | COC(O)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N(C)CN2 |
| InChI | InChI=1S/C17H19N3O5/c1-19-10-18-20-8-12(17(23)24-2)14(21)15(13(20)16(19)22)25-9-11-6-4-3-5-7-11/h3-8,17-18,23H,9-10H2,1-2H3 |
| InChIKey | ARLIHGJKKQEFEF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|