C24H27F2NO2 — CID 156560675
4-[4-(difluoromethyl)phenyl]-1-[1-[4-(3-methoxyoxetan-3-yl)phenyl]ethenyl]piperidine (PubChem CID 156560675) has the molecular formula C24H27F2NO2 and a molecular weight of 399.48 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)phenyl]-1-[1-[4-(3-methoxyoxetan-3-yl)phenyl]ethenyl]piperidine.
| Compound Name | 4-[4-(difluoromethyl)phenyl]-1-[1-[4-(3-methoxyoxetan-3-yl)phenyl]ethenyl]piperidine |
|---|---|
| PubChem CID | 156560675 |
| Molecular Formula | C24H27F2NO2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[4-(difluoromethyl)phenyl]-1-[1-[4-(3-methoxyoxetan-3-yl)phenyl]ethenyl]piperidine |
| SMILES | C=C(c1ccc(C2(OC)COC2)cc1)N1CCC(c2ccc(C(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H27F2NO2/c1-17(18-7-9-22(10-8-18)24(28-2)15-29-16-24)27-13-11-20(12-14-27)19-3-5-21(6-4-19)23(25)26/h3-10,20,23H,1,11-16H2,2H3 |
| InChIKey | VHJZAMJAHYKUEJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |