C21H24BrN5O3 — CID 156561227
N-[[4-[5-(2-bromoethoxy)pyrimidin-4-yl]-2-methylphenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 156561227) has the molecular formula C21H24BrN5O3 and a molecular weight of 474.36 g/mol. Its IUPAC name is N-[[4-[5-(2-bromoethoxy)pyrimidin-4-yl]-2-methylphenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[[4-[5-(2-bromoethoxy)pyrimidin-4-yl]-2-methylphenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 156561227 |
| Molecular Formula | C21H24BrN5O3 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[[4-[5-(2-bromoethoxy)pyrimidin-4-yl]-2-methylphenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cc1cc(-c2ncncc2OCCBr)ccc1CNC(=O)c1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C21H24BrN5O3/c1-13-9-14(17-16(29-8-7-22)11-23-12-25-17)5-6-15(13)10-24-19(28)18-26-20(30-27-18)21(2,3)4/h5-6,9,11-12H,7-8,10H2,1-4H3,(H,24,28) |
| InChIKey | WGEWMJXECAKWHM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|