C28H25N3O4 — CID 156562483
2-[2-ethoxy-4-[6-[2-(1-ethynylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenoxy]acetic acid (PubChem CID 156562483) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[6-[2-(1-ethynylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[6-[2-(1-ethynylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 156562483 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[2-ethoxy-4-[6-[2-(1-ethynylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenoxy]acetic acid |
| SMILES | C#Cc1c(CCNc2cc(-c3ccc(OCC(=O)O)c(OCC)c3)ncn2)ccc2ccccc12 |
| InChI | InChI=1S/C28H25N3O4/c1-3-22-20(10-9-19-7-5-6-8-23(19)22)13-14-29-27-16-24(30-18-31-27)21-11-12-25(35-17-28(32)33)26(15-21)34-4-2/h1,5-12,15-16,18H,4,13-14,17H2,2H3,(H,32,33)(H,29,30,31) |
| InChIKey | MPKORLHZVWEDGA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|