C27H29N5O2 — CID 153408420
2-[2-ethoxy-4-[6-[2-(1-methylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenyl]-N'-hydroxyethanimidamide (PubChem CID 153408420) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[6-[2-(1-methylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[2-ethoxy-4-[6-[2-(1-methylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 153408420 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-[2-ethoxy-4-[6-[2-(1-methylnaphthalen-2-yl)ethylamino]pyrimidin-4-yl]phenyl]-N'-hydroxyethanimidamide |
| SMILES | CCOc1cc(-c2cc(NCCc3ccc4ccccc4c3C)ncn2)ccc1CC(N)=NO |
| InChI | InChI=1S/C27H29N5O2/c1-3-34-25-14-21(10-11-22(25)15-26(28)32-33)24-16-27(31-17-30-24)29-13-12-19-8-9-20-6-4-5-7-23(20)18(19)2/h4-11,14,16-17,33H,3,12-13,15H2,1-2H3,(H2,28,32)(H,29,30,31) |
| InChIKey | FTBWFGDPPXZYLR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|