C26H27N5O3 — CID 175777517
2-ethoxy-N'-hydroxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzenecarboximidamide (PubChem CID 175777517) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-ethoxy-N'-hydroxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzenecarboximidamide.
| Compound Name | 2-ethoxy-N'-hydroxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 175777517 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-ethoxy-N'-hydroxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzenecarboximidamide |
| SMILES | CCOc1cc(-c2cc(NCCc3c(OC)ccc4ccccc34)ncn2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C26H27N5O3/c1-3-34-24-14-18(8-10-21(24)26(27)31-32)22-15-25(30-16-29-22)28-13-12-20-19-7-5-4-6-17(19)9-11-23(20)33-2/h4-11,14-16,32H,3,12-13H2,1-2H3,(H2,27,31)(H,28,29,30) |
| InChIKey | UZRYBQSJIAYBAO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|