About 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine
1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine (PubChem CID 156563730) has the molecular formula C23H25Cl2N3
and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine |
| PubChem CID | 156563730 |
| Molecular Formula | C23H25Cl2N3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine |
| SMILES | CN(C)CCCc1ccc(Nc2ccccc2Cl)c(Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H25Cl2N3/c1-28(2)15-7-8-17-13-14-22(26-20-11-5-3-9-18(20)24)23(16-17)27-21-12-6-4-10-19(21)25/h3-6,9-14,16,26-27H,7-8,15H2,1-2H3 |
| InChIKey | LOUBZWUYDIIMOJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine?
The IUPAC name of 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine (CID 156563730) is 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine.
What is the SMILES notation for 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine?
The canonical SMILES for 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine is CN(C)CCCc1ccc(Nc2ccccc2Cl)c(Nc2ccccc2Cl)c1.
What is the InChIKey of 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine?
The InChIKey is LOUBZWUYDIIMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3/c1-28(2)15-7-8-17-13-14-22(26-20-11-5-3-9-18(20)24)23(16-17)27-21-12-6-4-10-19(21)25/h3-6,9-14,16,26-27H,7-8,15H2,1-2H3.
What are the key properties of 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine?
1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine has a molecular weight of 414.38 g/mol, XLogP of 6.97, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis(2-chlorophenyl)-4-[3-(dimethylamino)propyl]benzene-1,2-diamine is sourced from PubChem (CID 156563730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).