C19H21ClF3N5O2 — CID 156563933
11-chloro-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156563933) has the molecular formula C19H21ClF3N5O2 and a molecular weight of 443.86 g/mol. Its IUPAC name is 11-chloro-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-chloro-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156563933 |
| Molecular Formula | C19H21ClF3N5O2 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 11-chloro-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | O=C(NC1CCC2(CCCO2)CC1)N1CC(C(F)(F)F)c2c1cnc1cc(Cl)nn21 |
| InChI | InChI=1S/C19H21ClF3N5O2/c20-14-8-15-24-9-13-16(28(15)26-14)12(19(21,22)23)10-27(13)17(29)25-11-2-5-18(6-3-11)4-1-7-30-18/h8-9,11-12H,1-7,10H2,(H,25,29) |
| InChIKey | AZIFSEMVJASAAF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |