C24H30Cl2F6N8O2 — CID 156565942
1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;5-chloro-6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 156565942) has the molecular formula C24H30Cl2F6N8O2 and a molecular weight of 647.45 g/mol. Its IUPAC name is 1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;5-chloro-6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;5-chloro-6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 156565942 |
| Molecular Formula | C24H30Cl2F6N8O2 |
| Molecular Weight | 647.45 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | 1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;5-chloro-6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1cnc(N2CCN(CCC(F)(F)F)CC2)c(Cl)c1.O=[N+]([O-])c1cnc(N2CCN(CCC(F)(F)F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClF3N4O2.C12H16ClF3N4/c13-10-7-9(20(21)22)8-17-11(10)19-5-3-18(4-6-19)2-1-12(14,15)16;13-10-7-9(17)8-18-11(10)20-5-3-19(4-6-20)2-1-12(14,15)16/h7-8H,1-6H2;7-8H,1-6,17H2 |
| InChIKey | XLWZRDKCSNOBRL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|