C10H16NO3S- — CID 156566214
4-[[[(1E)-buta-1,3-dienyl]-sulfinatoamino]methyl]oxane (PubChem CID 156566214) has the molecular formula C10H16NO3S- and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[[[(1E)-buta-1,3-dienyl]-sulfinatoamino]methyl]oxane.
| Compound Name | 4-[[[(1E)-buta-1,3-dienyl]-sulfinatoamino]methyl]oxane |
|---|---|
| PubChem CID | 156566214 |
| Molecular Formula | C10H16NO3S- |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-[[[(1E)-buta-1,3-dienyl]-sulfinatoamino]methyl]oxane |
| SMILES | C=C/C=C/N(CC1CCOCC1)S(=O)[O-] |
| InChI | InChI=1S/C10H17NO3S/c1-2-3-6-11(15(12)13)9-10-4-7-14-8-5-10/h2-3,6,10H,1,4-5,7-9H2,(H,12,13)/p-1/b6-3+ |
| InChIKey | IOLWBXILXUOBIH-ZZXKWVIFSA-M |
| XLogP | 1.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|