C21H15F3N4O2S2 — CID 156568205
4-[[1-(4-formyl-1,3-thiazol-2-yl)-3-phenyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]benzenesulfinamide (PubChem CID 156568205) has the molecular formula C21H15F3N4O2S2 and a molecular weight of 476.51 g/mol. Its IUPAC name is 4-[[1-(4-formyl-1,3-thiazol-2-yl)-3-phenyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]benzenesulfinamide.
| Compound Name | 4-[[1-(4-formyl-1,3-thiazol-2-yl)-3-phenyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]benzenesulfinamide |
|---|---|
| PubChem CID | 156568205 |
| Molecular Formula | C21H15F3N4O2S2 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 4-[[1-(4-formyl-1,3-thiazol-2-yl)-3-phenyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]benzenesulfinamide |
| SMILES | NS(=O)c1ccc(Cc2c(-c3ccccc3)nn(-c3nc(C=O)cs3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F3N4O2S2/c22-21(23,24)19-17(10-13-6-8-16(9-7-13)32(25)30)18(14-4-2-1-3-5-14)27-28(19)20-26-15(11-29)12-31-20/h1-9,11-12H,10,25H2 |
| InChIKey | LGNRBYWPJBGGNE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|