C20H26N2O2 — CID 156569422
2-[(15R)-1-(hydroxymethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraen-17-yl]ethanol (PubChem CID 156569422) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(15R)-1-(hydroxymethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraen-17-yl]ethanol.
| Compound Name | 2-[(15R)-1-(hydroxymethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraen-17-yl]ethanol |
|---|---|
| PubChem CID | 156569422 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[(15R)-1-(hydroxymethyl)-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraen-17-yl]ethanol |
| SMILES | OCCC1C[C@H]2CN3CCc4c([nH]c5ccccc45)C(CO)(C2)C13 |
| InChI | InChI=1S/C20H26N2O2/c23-8-6-14-9-13-10-20(12-24)18-16(5-7-22(11-13)19(14)20)15-3-1-2-4-17(15)21-18/h1-4,13-14,19,21,23-24H,5-12H2/t13-,14?,19?,20?/m1/s1 |
| InChIKey | NEQDLNSKPFFASR-CFBMZVTASA-N |
| XLogP | 2.05 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |