C28H38N8O3 — CID 156569510
tert-butyl 4-[6-[[15-(2-methylpropyl)-11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraen-4-yl]amino]-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 156569510) has the molecular formula C28H38N8O3 and a molecular weight of 534.67 g/mol. Its IUPAC name is tert-butyl 4-[6-[[15-(2-methylpropyl)-11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraen-4-yl]amino]-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[[15-(2-methylpropyl)-11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraen-4-yl]amino]-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156569510 |
| Molecular Formula | C28H38N8O3 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | tert-butyl 4-[6-[[15-(2-methylpropyl)-11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraen-4-yl]amino]-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)CC1CNC2OC2c2cc3cnc(Nc4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)cn4)nc3n21 |
| InChI | InChI=1S/C28H38N8O3/c1-17(2)12-20-16-30-25-23(38-25)21-13-18-14-31-26(33-24(18)36(20)21)32-22-7-6-19(15-29-22)34-8-10-35(11-9-34)27(37)39-28(3,4)5/h6-7,13-15,17,20,23,25,30H,8-12,16H2,1-5H3,(H,29,31,32,33) |
| InChIKey | XDGXNAMDNMYYIF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|