C23H27N7O2 — CID 146246858
N-(5-morpholin-4-yl-2-pyridinyl)spiro[11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraene-15,1'-cyclopentane]-4-amine (PubChem CID 146246858) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-(5-morpholin-4-yl-2-pyridinyl)spiro[11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraene-15,1'-cyclopentane]-4-amine.
| Compound Name | N-(5-morpholin-4-yl-2-pyridinyl)spiro[11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraene-15,1'-cyclopentane]-4-amine |
|---|---|
| PubChem CID | 146246858 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-(5-morpholin-4-yl-2-pyridinyl)spiro[11-oxa-1,3,5,13-tetrazatetracyclo[7.6.0.02,7.010,12]pentadeca-2,4,6,8-tetraene-15,1'-cyclopentane]-4-amine |
| SMILES | c1cc(Nc2ncc3cc4n(c3n2)C2(CCCC2)CNC2OC42)ncc1N1CCOCC1 |
| InChI | InChI=1S/C23H27N7O2/c1-2-6-23(5-1)14-26-21-19(32-21)17-11-15-12-25-22(28-20(15)30(17)23)27-18-4-3-16(13-24-18)29-7-9-31-10-8-29/h3-4,11-13,19,21,26H,1-2,5-10,14H2,(H,24,25,27,28) |
| InChIKey | SQAXKTRFONRQOA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|