C26H36N8O — CID 170081621
13-[[5-(4-cyclobutylpiperazin-1-yl)-2-pyridinyl]amino]-3,10,12,14-tetrazatricyclo[8.7.0.011,16]heptadeca-1(17),11,13,15-tetraen-2-ol (PubChem CID 170081621) has the molecular formula C26H36N8O and a molecular weight of 476.63 g/mol. Its IUPAC name is 13-[[5-(4-cyclobutylpiperazin-1-yl)-2-pyridinyl]amino]-3,10,12,14-tetrazatricyclo[8.7.0.011,16]heptadeca-1(17),11,13,15-tetraen-2-ol.
| Compound Name | 13-[[5-(4-cyclobutylpiperazin-1-yl)-2-pyridinyl]amino]-3,10,12,14-tetrazatricyclo[8.7.0.011,16]heptadeca-1(17),11,13,15-tetraen-2-ol |
|---|---|
| PubChem CID | 170081621 |
| Molecular Formula | C26H36N8O |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 13-[[5-(4-cyclobutylpiperazin-1-yl)-2-pyridinyl]amino]-3,10,12,14-tetrazatricyclo[8.7.0.011,16]heptadeca-1(17),11,13,15-tetraen-2-ol |
| SMILES | OC1NCCCCCCn2c1cc1cnc(Nc3ccc(N4CCN(C5CCC5)CC4)cn3)nc12 |
| InChI | InChI=1S/C26H36N8O/c35-25-22-16-19-17-29-26(31-24(19)34(22)11-4-2-1-3-10-27-25)30-23-9-8-21(18-28-23)33-14-12-32(13-15-33)20-6-5-7-20/h8-9,16-18,20,25,27,35H,1-7,10-15H2,(H,28,29,30,31) |
| InChIKey | HXHVFSSTYLQBEF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |