C25H34N8O — CID 126571441
14-[[5-(3,5-dimethylpiperazin-1-yl)-2-pyridinyl]amino]-3,11,13,15-tetrazatricyclo[9.7.0.012,17]octadeca-1(18),12,14,16-tetraen-2-one (PubChem CID 126571441) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is 14-[[5-(3,5-dimethylpiperazin-1-yl)-2-pyridinyl]amino]-3,11,13,15-tetrazatricyclo[9.7.0.012,17]octadeca-1(18),12,14,16-tetraen-2-one.
| Compound Name | 14-[[5-(3,5-dimethylpiperazin-1-yl)-2-pyridinyl]amino]-3,11,13,15-tetrazatricyclo[9.7.0.012,17]octadeca-1(18),12,14,16-tetraen-2-one |
|---|---|
| PubChem CID | 126571441 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 14-[[5-(3,5-dimethylpiperazin-1-yl)-2-pyridinyl]amino]-3,11,13,15-tetrazatricyclo[9.7.0.012,17]octadeca-1(18),12,14,16-tetraen-2-one |
| SMILES | CC1CN(c2ccc(Nc3ncc4cc5n(c4n3)CCCCCCCNC5=O)nc2)CC(C)N1 |
| InChI | InChI=1S/C25H34N8O/c1-17-15-32(16-18(2)29-17)20-8-9-22(27-14-20)30-25-28-13-19-12-21-24(34)26-10-6-4-3-5-7-11-33(21)23(19)31-25/h8-9,12-14,17-18,29H,3-7,10-11,15-16H2,1-2H3,(H,26,34)(H,27,28,30,31) |
| InChIKey | QMGCMRWEJSMWOY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |