C22H26N8O — CID 170078366
(2S,6S)-14-[[5-(1,4-diazepan-1-yl)-2-pyridinyl]amino]-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one (PubChem CID 170078366) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is (2S,6S)-14-[[5-(1,4-diazepan-1-yl)-2-pyridinyl]amino]-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one.
| Compound Name | (2S,6S)-14-[[5-(1,4-diazepan-1-yl)-2-pyridinyl]amino]-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one |
|---|---|
| PubChem CID | 170078366 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (2S,6S)-14-[[5-(1,4-diazepan-1-yl)-2-pyridinyl]amino]-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one |
| SMILES | O=C1N[C@H]2CCC[C@@H]2n2c1cc1cnc(Nc3ccc(N4CCCNCC4)cn3)nc12 |
| InChI | InChI=1S/C22H26N8O/c31-21-18-11-14-12-25-22(28-20(14)30(18)17-4-1-3-16(17)26-21)27-19-6-5-15(13-24-19)29-9-2-7-23-8-10-29/h5-6,11-13,16-17,23H,1-4,7-10H2,(H,26,31)(H,24,25,27,28)/t16-,17-/m0/s1 |
| InChIKey | NZTKARWCFLMBCE-IRXDYDNUSA-N |
| XLogP | 2.21 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |