C24H29N9O2 — CID 70900380
14-[[5-[4-(2-aminoacetyl)piperazin-1-yl]-2-pyridinyl]amino]-7-methyl-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one (PubChem CID 70900380) has the molecular formula C24H29N9O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 14-[[5-[4-(2-aminoacetyl)piperazin-1-yl]-2-pyridinyl]amino]-7-methyl-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one.
| Compound Name | 14-[[5-[4-(2-aminoacetyl)piperazin-1-yl]-2-pyridinyl]amino]-7-methyl-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one |
|---|---|
| PubChem CID | 70900380 |
| Molecular Formula | C24H29N9O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 14-[[5-[4-(2-aminoacetyl)piperazin-1-yl]-2-pyridinyl]amino]-7-methyl-1,7,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11,13,15-tetraen-8-one |
| SMILES | CN1C(=O)c2cc3cnc(Nc4ccc(N5CCN(C(=O)CN)CC5)cn4)nc3n2C2CCCC21 |
| InChI | InChI=1S/C24H29N9O2/c1-30-17-3-2-4-18(17)33-19(23(30)35)11-15-13-27-24(29-22(15)33)28-20-6-5-16(14-26-20)31-7-9-32(10-8-31)21(34)12-25/h5-6,11,13-14,17-18H,2-4,7-10,12,25H2,1H3,(H,26,27,28,29) |
| InChIKey | WQTBNIIZIAZVFA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |