C22H20ClFN4O2S2 — CID 156570129
N-(3-chloro-4-fluorophenyl)-1-oxo-2-prop-2-enyl-5-(5-pyridin-2-ylthiophen-2-yl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 156570129) has the molecular formula C22H20ClFN4O2S2 and a molecular weight of 491.01 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-oxo-2-prop-2-enyl-5-(5-pyridin-2-ylthiophen-2-yl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-oxo-2-prop-2-enyl-5-(5-pyridin-2-ylthiophen-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 156570129 |
| Molecular Formula | C22H20ClFN4O2S2 |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-oxo-2-prop-2-enyl-5-(5-pyridin-2-ylthiophen-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | C=CCN1C(C(=O)Nc2ccc(F)c(Cl)c2)CC(c2ccc(-c3ccccn3)s2)NS1=O |
| InChI | InChI=1S/C22H20ClFN4O2S2/c1-2-11-28-19(22(29)26-14-6-7-16(24)15(23)12-14)13-18(27-32(28)30)21-9-8-20(31-21)17-5-3-4-10-25-17/h2-10,12,18-19,27H,1,11,13H2,(H,26,29) |
| InChIKey | DPSUIMLBTOKBSU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|