C16H18ClFN2OS — CID 156570424
4-amino-N-(3-chloro-4-fluorophenyl)-2-methyl-4-(5-methylthiophen-2-yl)butanamide (PubChem CID 156570424) has the molecular formula C16H18ClFN2OS and a molecular weight of 340.85 g/mol. Its IUPAC name is 4-amino-N-(3-chloro-4-fluorophenyl)-2-methyl-4-(5-methylthiophen-2-yl)butanamide.
| Compound Name | 4-amino-N-(3-chloro-4-fluorophenyl)-2-methyl-4-(5-methylthiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 156570424 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-amino-N-(3-chloro-4-fluorophenyl)-2-methyl-4-(5-methylthiophen-2-yl)butanamide |
| SMILES | Cc1ccc(C(N)CC(C)C(=O)Nc2ccc(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C16H18ClFN2OS/c1-9(7-14(19)15-6-3-10(2)22-15)16(21)20-11-4-5-13(18)12(17)8-11/h3-6,8-9,14H,7,19H2,1-2H3,(H,20,21) |
| InChIKey | MVEXBIAFUJNLMN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |