C24H24F2N4O3S — CID 156570692
3-(difluoromethyl)-N-[5-(3-oxomorpholin-4-yl)-1-(thian-4-yl)benzimidazol-2-yl]benzamide (PubChem CID 156570692) has the molecular formula C24H24F2N4O3S and a molecular weight of 486.54 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-[5-(3-oxomorpholin-4-yl)-1-(thian-4-yl)benzimidazol-2-yl]benzamide.
| Compound Name | 3-(difluoromethyl)-N-[5-(3-oxomorpholin-4-yl)-1-(thian-4-yl)benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 156570692 |
| Molecular Formula | C24H24F2N4O3S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 3-(difluoromethyl)-N-[5-(3-oxomorpholin-4-yl)-1-(thian-4-yl)benzimidazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc2cc(N3CCOCC3=O)ccc2n1C1CCSCC1)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C24H24F2N4O3S/c25-22(26)15-2-1-3-16(12-15)23(32)28-24-27-19-13-18(29-8-9-33-14-21(29)31)4-5-20(19)30(24)17-6-10-34-11-7-17/h1-5,12-13,17,22H,6-11,14H2,(H,27,28,32) |
| InChIKey | ITQLWILMJHYELT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |