C23H23F2N5O4 — CID 126720176
3-[2-[[3-(difluoromethyl)benzoyl]amino]-5-(2-oxopiperazin-1-yl)benzimidazol-1-yl]propyl formate (PubChem CID 126720176) has the molecular formula C23H23F2N5O4 and a molecular weight of 471.46 g/mol. Its IUPAC name is 3-[2-[[3-(difluoromethyl)benzoyl]amino]-5-(2-oxopiperazin-1-yl)benzimidazol-1-yl]propyl formate.
| Compound Name | 3-[2-[[3-(difluoromethyl)benzoyl]amino]-5-(2-oxopiperazin-1-yl)benzimidazol-1-yl]propyl formate |
|---|---|
| PubChem CID | 126720176 |
| Molecular Formula | C23H23F2N5O4 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 3-[2-[[3-(difluoromethyl)benzoyl]amino]-5-(2-oxopiperazin-1-yl)benzimidazol-1-yl]propyl formate |
| SMILES | O=COCCCn1c(NC(=O)c2cccc(C(F)F)c2)nc2cc(N3CCNCC3=O)ccc21 |
| InChI | InChI=1S/C23H23F2N5O4/c24-21(25)15-3-1-4-16(11-15)22(33)28-23-27-18-12-17(29-9-7-26-13-20(29)32)5-6-19(18)30(23)8-2-10-34-14-31/h1,3-6,11-12,14,21,26H,2,7-10,13H2,(H,27,28,33) |
| InChIKey | IDQHKZYYZMZPOY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|