C24H23F3N4O5 — CID 126720180
3-[5-(2-oxo-1,3-oxazinan-3-yl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-1-yl]butyl formate (PubChem CID 126720180) has the molecular formula C24H23F3N4O5 and a molecular weight of 504.47 g/mol. Its IUPAC name is 3-[5-(2-oxo-1,3-oxazinan-3-yl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-1-yl]butyl formate.
| Compound Name | 3-[5-(2-oxo-1,3-oxazinan-3-yl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-1-yl]butyl formate |
|---|---|
| PubChem CID | 126720180 |
| Molecular Formula | C24H23F3N4O5 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 3-[5-(2-oxo-1,3-oxazinan-3-yl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-1-yl]butyl formate |
| SMILES | CC(CCOC=O)n1c(NC(=O)c2cccc(C(F)(F)F)c2)nc2cc(N3CCCOC3=O)ccc21 |
| InChI | InChI=1S/C24H23F3N4O5/c1-15(8-11-35-14-32)31-20-7-6-18(30-9-3-10-36-23(30)34)13-19(20)28-22(31)29-21(33)16-4-2-5-17(12-16)24(25,26)27/h2,4-7,12-15H,3,8-11H2,1H3,(H,28,29,33) |
| InChIKey | CBDXPZPSLXYCIV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|