C23H19F3N4O — CID 118118132
N-[1-(3-aminophenyl)-5-ethylbenzimidazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 118118132) has the molecular formula C23H19F3N4O and a molecular weight of 424.43 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)-5-ethylbenzimidazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(3-aminophenyl)-5-ethylbenzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118118132 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[1-(3-aminophenyl)-5-ethylbenzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCc1ccc2c(c1)nc(NC(=O)c1cccc(C(F)(F)F)c1)n2-c1cccc(N)c1 |
| InChI | InChI=1S/C23H19F3N4O/c1-2-14-9-10-20-19(11-14)28-22(30(20)18-8-4-7-17(27)13-18)29-21(31)15-5-3-6-16(12-15)23(24,25)26/h3-13H,2,27H2,1H3,(H,28,29,31) |
| InChIKey | OJHGUUGPCHDVMS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|