C39H42F3N5O6S — CID 138620601
4-methyl-2-[2-[2-[2-[4-[[1-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-5-yl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]benzenesulfonic acid (PubChem CID 138620601) has the molecular formula C39H42F3N5O6S and a molecular weight of 765.86 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-[2-[4-[[1-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-5-yl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-[2-[2-[4-[[1-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-5-yl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 138620601 |
| Molecular Formula | C39H42F3N5O6S |
| Molecular Weight | 765.86 g/mol |
| Exact Mass | 765.28 |
| IUPAC Name | 4-methyl-2-[2-[2-[2-[4-[[1-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzimidazol-5-yl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCOCCN2CCN(Cc3ccc4c(c3)nc(NC(=O)c3cccc(C(F)(F)F)c3)n4-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C39H42F3N5O6S/c1-28-10-13-36(54(49,50)51)30(24-28)14-20-52-22-23-53-21-19-45-15-17-46(18-16-45)27-29-11-12-35-34(25-29)43-38(47(35)33-8-3-2-4-9-33)44-37(48)31-6-5-7-32(26-31)39(40,41)42/h2-13,24-26H,14-23,27H2,1H3,(H,43,44,48)(H,49,50,51) |
| InChIKey | FAVVOCMBRHCPRH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.86 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|