C21H19F4N3O — CID 138656728
N-(1-cyclohexyl-5-fluorobenzimidazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 138656728) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is N-(1-cyclohexyl-5-fluorobenzimidazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-cyclohexyl-5-fluorobenzimidazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 138656728 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(1-cyclohexyl-5-fluorobenzimidazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2cc(F)ccc2n1C1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F4N3O/c22-15-9-10-18-17(12-15)26-20(28(18)16-7-2-1-3-8-16)27-19(29)13-5-4-6-14(11-13)21(23,24)25/h4-6,9-12,16H,1-3,7-8H2,(H,26,27,29) |
| InChIKey | AYSMDHVGWVNJIB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |