C27H33N5O2 — CID 164600976
3-N-[1-cyclohexyl-5-(piperidin-1-ylmethyl)benzimidazol-2-yl]benzene-1,3-dicarboxamide (PubChem CID 164600976) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-N-[1-cyclohexyl-5-(piperidin-1-ylmethyl)benzimidazol-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[1-cyclohexyl-5-(piperidin-1-ylmethyl)benzimidazol-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 164600976 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 3-N-[1-cyclohexyl-5-(piperidin-1-ylmethyl)benzimidazol-2-yl]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2nc3cc(CN4CCCCC4)ccc3n2C2CCCCC2)c1 |
| InChI | InChI=1S/C27H33N5O2/c28-25(33)20-8-7-9-21(17-20)26(34)30-27-29-23-16-19(18-31-14-5-2-6-15-31)12-13-24(23)32(27)22-10-3-1-4-11-22/h7-9,12-13,16-17,22H,1-6,10-11,14-15,18H2,(H2,28,33)(H,29,30,34) |
| InChIKey | DWGXJLWERDGCCB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |