C22H32N4O2 — CID 138657004
ethyl 4-[2-amino-5-(piperidin-1-ylmethyl)benzimidazol-1-yl]cyclohexane-1-carboxylate (PubChem CID 138657004) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethyl 4-[2-amino-5-(piperidin-1-ylmethyl)benzimidazol-1-yl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[2-amino-5-(piperidin-1-ylmethyl)benzimidazol-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 138657004 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | ethyl 4-[2-amino-5-(piperidin-1-ylmethyl)benzimidazol-1-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(n2c(N)nc3cc(CN4CCCCC4)ccc32)CC1 |
| InChI | InChI=1S/C22H32N4O2/c1-2-28-21(27)17-7-9-18(10-8-17)26-20-11-6-16(14-19(20)24-22(26)23)15-25-12-4-3-5-13-25/h6,11,14,17-18H,2-5,7-10,12-13,15H2,1H3,(H2,23,24) |
| InChIKey | QBWAHYSMQOYMNM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |