C20H19FN4O4 — CID 127034635
N-[5-fluoro-1-[(1S,3S)-3-(hydroxymethyl)cyclopentyl]benzimidazol-2-yl]-3-nitrobenzamide (PubChem CID 127034635) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is N-[5-fluoro-1-[(1S,3S)-3-(hydroxymethyl)cyclopentyl]benzimidazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[5-fluoro-1-[(1S,3S)-3-(hydroxymethyl)cyclopentyl]benzimidazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 127034635 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[5-fluoro-1-[(1S,3S)-3-(hydroxymethyl)cyclopentyl]benzimidazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1nc2cc(F)ccc2n1[C@H]1CC[C@H](CO)C1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19FN4O4/c21-14-5-7-18-17(10-14)22-20(24(18)15-6-4-12(8-15)11-26)23-19(27)13-2-1-3-16(9-13)25(28)29/h1-3,5,7,9-10,12,15,26H,4,6,8,11H2,(H,22,23,27)/t12-,15-/m0/s1 |
| InChIKey | DQEONMVYEBMSJA-WFASDCNBSA-N |
| XLogP | 3.67 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|