C57H37N3O2 — CID 156575048
4-(6-dibenzofuran-3-yl-4-phenyldibenzofuran-1-yl)-2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazine (PubChem CID 156575048) has the molecular formula C57H37N3O2 and a molecular weight of 795.94 g/mol. Its IUPAC name is 4-(6-dibenzofuran-3-yl-4-phenyldibenzofuran-1-yl)-2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazine.
| Compound Name | 4-(6-dibenzofuran-3-yl-4-phenyldibenzofuran-1-yl)-2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 156575048 |
| Molecular Formula | C57H37N3O2 |
| Molecular Weight | 795.94 g/mol |
| Exact Mass | 795.29 |
| IUPAC Name | 4-(6-dibenzofuran-3-yl-4-phenyldibenzofuran-1-yl)-2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(C3=NC(c4ccc(-c5ccccc5)c5oc6c(-c7ccc8c(c7)oc7ccccc78)cccc6c45)=NC(c4cccc(-c5ccccc5)c4)N3)c2)cc1 |
| InChI | InChI=1S/C57H37N3O2/c1-4-15-36(16-5-1)39-21-12-23-42(33-39)55-58-56(43-24-13-22-40(34-43)37-17-6-2-7-18-37)60-57(59-55)49-32-31-45(38-19-8-3-9-20-38)54-52(49)48-27-14-26-44(53(48)62-54)41-29-30-47-46-25-10-11-28-50(46)61-51(47)35-41/h1-35,55H,(H,58,59,60) |
| InChIKey | YCIBMRWNZHFGCF-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.94 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |