C44H30N4O2 — CID 159444306
5-(6-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-6-(3-phenylphenyl)-1,2-dihydro-[1]benzofuro[2,3-b]pyridine (PubChem CID 159444306) has the molecular formula C44H30N4O2 and a molecular weight of 646.75 g/mol. Its IUPAC name is 5-(6-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-6-(3-phenylphenyl)-1,2-dihydro-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 5-(6-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-6-(3-phenylphenyl)-1,2-dihydro-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 159444306 |
| Molecular Formula | C44H30N4O2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 5-(6-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-6-(3-phenylphenyl)-1,2-dihydro-[1]benzofuro[2,3-b]pyridine |
| SMILES | C1=Cc2c(oc3ccc(-c4cccc(-c5ccccc5)c4)c(C4=NC(c5ccccc5)NC(c5ccc6c(c5)oc5ccccc56)=N4)c23)NC1 |
| InChI | InChI=1S/C44H30N4O2/c1-3-11-27(12-4-1)29-15-9-16-30(25-29)32-22-23-37-39(35-18-10-24-45-44(35)50-37)40(32)43-47-41(28-13-5-2-6-14-28)46-42(48-43)31-20-21-34-33-17-7-8-19-36(33)49-38(34)26-31/h1-23,25-26,41,45H,24H2,(H,46,47,48) |
| InChIKey | LSONNENBTRRFOV-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |