C23H48N2 — CID 156578109
N'-butyl-N-(5-tert-butyl-1-methylcyclononyl)-N'-methylbutane-1,4-diamine (PubChem CID 156578109) has the molecular formula C23H48N2 and a molecular weight of 352.65 g/mol. Its IUPAC name is N'-butyl-N-(5-tert-butyl-1-methylcyclononyl)-N'-methylbutane-1,4-diamine.
| Compound Name | N'-butyl-N-(5-tert-butyl-1-methylcyclononyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 156578109 |
| Molecular Formula | C23H48N2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.38 |
| IUPAC Name | N'-butyl-N-(5-tert-butyl-1-methylcyclononyl)-N'-methylbutane-1,4-diamine |
| SMILES | CCCCN(C)CCCCNC1(C)CCCCC(C(C)(C)C)CCC1 |
| InChI | InChI=1S/C23H48N2/c1-7-8-19-25(6)20-12-11-18-24-23(5)16-10-9-14-21(15-13-17-23)22(2,3)4/h21,24H,7-20H2,1-6H3 |
| InChIKey | QLQLBTIEZBIILX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|