C19H21ClFN3O2 — CID 156578313
N'-(4-chloro-2-fluorophenyl)-N-(3-methoxyanilino)-3,3-dimethyl-2-oxobutanimidamide (PubChem CID 156578313) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)-N-(3-methoxyanilino)-3,3-dimethyl-2-oxobutanimidamide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)-N-(3-methoxyanilino)-3,3-dimethyl-2-oxobutanimidamide |
|---|---|
| PubChem CID | 156578313 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)-N-(3-methoxyanilino)-3,3-dimethyl-2-oxobutanimidamide |
| SMILES | COc1cccc(NN/C(=N\c2ccc(Cl)cc2F)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-19(2,3)17(25)18(22-16-9-8-12(20)10-15(16)21)24-23-13-6-5-7-14(11-13)26-4/h5-11,23H,1-4H3,(H,22,24) |
| InChIKey | WRFHWDKWJYQQJQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|