C15H18O4 — CID 156581392
(2R,3R,7R)-3-hydroxy-7-methyl-2-propan-2-yl-2,3,6,7-tetrahydrofuro[3,2-h]isochromen-9-one (PubChem CID 156581392) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (2R,3R,7R)-3-hydroxy-7-methyl-2-propan-2-yl-2,3,6,7-tetrahydrofuro[3,2-h]isochromen-9-one.
| Compound Name | (2R,3R,7R)-3-hydroxy-7-methyl-2-propan-2-yl-2,3,6,7-tetrahydrofuro[3,2-h]isochromen-9-one |
|---|---|
| PubChem CID | 156581392 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2R,3R,7R)-3-hydroxy-7-methyl-2-propan-2-yl-2,3,6,7-tetrahydrofuro[3,2-h]isochromen-9-one |
| SMILES | CC(C)[C@H]1Oc2c(ccc3c2C(=O)O[C@H](C)C3)[C@H]1O |
| InChI | InChI=1S/C15H18O4/c1-7(2)13-12(16)10-5-4-9-6-8(3)18-15(17)11(9)14(10)19-13/h4-5,7-8,12-13,16H,6H2,1-3H3/t8-,12-,13-/m1/s1 |
| InChIKey | XRFQIGJMQMCLBR-BZHVJNSISA-N |
| XLogP | 2.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |