C12H18O4 — CID 156581593
1-[5-(1,2-dihydroxypropyl)furan-2-yl]pentan-1-one (PubChem CID 156581593) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[5-(1,2-dihydroxypropyl)furan-2-yl]pentan-1-one.
| Compound Name | 1-[5-(1,2-dihydroxypropyl)furan-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 156581593 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[5-(1,2-dihydroxypropyl)furan-2-yl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(C(O)C(C)O)o1 |
| InChI | InChI=1S/C12H18O4/c1-3-4-5-9(14)10-6-7-11(16-10)12(15)8(2)13/h6-8,12-13,15H,3-5H2,1-2H3 |
| InChIKey | OPYJFZAEBBEQJG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |