C10H15NO2 — CID 156582313
(5R,6R,7S)-3,5-dimethyl-5,6,7,8-tetrahydroindolizine-6,7-diol (PubChem CID 156582313) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (5R,6R,7S)-3,5-dimethyl-5,6,7,8-tetrahydroindolizine-6,7-diol.
| Compound Name | (5R,6R,7S)-3,5-dimethyl-5,6,7,8-tetrahydroindolizine-6,7-diol |
|---|---|
| PubChem CID | 156582313 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (5R,6R,7S)-3,5-dimethyl-5,6,7,8-tetrahydroindolizine-6,7-diol |
| SMILES | Cc1ccc2n1[C@H](C)[C@@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C10H15NO2/c1-6-3-4-8-5-9(12)10(13)7(2)11(6)8/h3-4,7,9-10,12-13H,5H2,1-2H3/t7-,9+,10-/m1/s1 |
| InChIKey | CGPPZIICNTZQIN-FKTZTGRPSA-N |
| XLogP | 0.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |