C28H46O3 — CID 156582832
(2S,3R,5S,9R,10S,12S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol (PubChem CID 156582832) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (2S,3R,5S,9R,10S,12S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol.
| Compound Name | (2S,3R,5S,9R,10S,12S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
|---|---|
| PubChem CID | 156582832 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (2S,3R,5S,9R,10S,12S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3C[C@H](O)[C@]12C)C(C)C |
| InChI | InChI=1S/C28H46O3/c1-16(2)17(3)7-8-18(4)21-11-12-22-20-10-9-19-13-24(29)25(30)15-27(19,5)23(20)14-26(31)28(21,22)6/h10,16,18-19,21-26,29-31H,3,7-9,11-15H2,1-2,4-6H3/t18-,19+,21-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | PZFLLPAODZLJIV-GKTHOFNDSA-N |
| XLogP | 5.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|