C24H40O3 — CID 22295258
(9R,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol (PubChem CID 22295258) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (9R,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol.
| Compound Name | (9R,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
|---|---|
| PubChem CID | 22295258 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (9R,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| SMILES | C[C@H](CCCO)[C@H]1CC[C@H]2C3=CCC4CC(O)CC[C@]4(C)[C@H]3CC(O)[C@]12C |
| InChI | InChI=1S/C24H40O3/c1-15(5-4-12-25)19-8-9-20-18-7-6-16-13-17(26)10-11-23(16,2)21(18)14-22(27)24(19,20)3/h7,15-17,19-22,25-27H,4-6,8-14H2,1-3H3/t15-,16?,17?,19-,20+,21+,22?,23+,24-/m1/s1 |
| InChIKey | AESFWEGZDUOISG-CWAWFXJYSA-N |
| XLogP | 4.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|