C20H27N3O4 — CID 156584086
(4aR,6S,8aR)-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide (PubChem CID 156584086) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is (4aR,6S,8aR)-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,6S,8aR)-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 156584086 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (4aR,6S,8aR)-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide |
| SMILES | NC(=O)[C@H]1CC[C@H]2OCCN(C(=O)CN3CCOc4ccccc4C3)[C@@H]2C1 |
| InChI | InChI=1S/C20H27N3O4/c21-20(25)14-5-6-18-16(11-14)23(8-10-27-18)19(24)13-22-7-9-26-17-4-2-1-3-15(17)12-22/h1-4,14,16,18H,5-13H2,(H2,21,25)/t14-,16+,18+/m0/s1 |
| InChIKey | OKIZHCYJBLKTPA-YXJHDRRASA-N |
| XLogP | 0.76 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |