C19H31N5O4 — CID 156584290
1-ethyl-N-[(1R,2R,4S)-2-hydroxy-4-(3-morpholin-4-ylpropylcarbamoyl)cyclopentyl]pyrazole-4-carboxamide (PubChem CID 156584290) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-ethyl-N-[(1R,2R,4S)-2-hydroxy-4-(3-morpholin-4-ylpropylcarbamoyl)cyclopentyl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[(1R,2R,4S)-2-hydroxy-4-(3-morpholin-4-ylpropylcarbamoyl)cyclopentyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 156584290 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-ethyl-N-[(1R,2R,4S)-2-hydroxy-4-(3-morpholin-4-ylpropylcarbamoyl)cyclopentyl]pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)N[C@@H]2C[C@H](C(=O)NCCCN3CCOCC3)C[C@H]2O)cn1 |
| InChI | InChI=1S/C19H31N5O4/c1-2-24-13-15(12-21-24)19(27)22-16-10-14(11-17(16)25)18(26)20-4-3-5-23-6-8-28-9-7-23/h12-14,16-17,25H,2-11H2,1H3,(H,20,26)(H,22,27)/t14-,16+,17+/m0/s1 |
| InChIKey | CHEFRFSEZIDVIS-USXIJHARSA-N |
| XLogP | -0.39 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|