C19H25N5O4 — CID 156585035
(1S,3R,4R)-3-hydroxy-4-[[2-(3-methoxyphenyl)acetyl]amino]-N-(1H-1,2,4-triazol-5-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 156585035) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (1S,3R,4R)-3-hydroxy-4-[[2-(3-methoxyphenyl)acetyl]amino]-N-(1H-1,2,4-triazol-5-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-3-hydroxy-4-[[2-(3-methoxyphenyl)acetyl]amino]-N-(1H-1,2,4-triazol-5-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 156585035 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (1S,3R,4R)-3-hydroxy-4-[[2-(3-methoxyphenyl)acetyl]amino]-N-(1H-1,2,4-triazol-5-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | COc1cccc(CC(=O)N[C@@H]2CC[C@H](C(=O)NCc3ncn[nH]3)C[C@H]2O)c1 |
| InChI | InChI=1S/C19H25N5O4/c1-28-14-4-2-3-12(7-14)8-18(26)23-15-6-5-13(9-16(15)25)19(27)20-10-17-21-11-22-24-17/h2-4,7,11,13,15-16,25H,5-6,8-10H2,1H3,(H,20,27)(H,23,26)(H,21,22,24)/t13-,15+,16+/m0/s1 |
| InChIKey | FOQABDLDDQOGSK-NUEKZKHPSA-N |
| XLogP | 0.32 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |