C19H19F2N5OS — CID 156585834
N-[(2,3-difluorophenyl)methyl]-7-(1,2-thiazol-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 156585834) has the molecular formula C19H19F2N5OS and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-7-(1,2-thiazol-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-7-(1,2-thiazol-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 156585834 |
| Molecular Formula | C19H19F2N5OS |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-7-(1,2-thiazol-4-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1F)c1cn2c(n1)CCN(Cc1cnsc1)CC2 |
| InChI | InChI=1S/C19H19F2N5OS/c20-15-3-1-2-14(18(15)21)9-22-19(27)16-11-26-7-6-25(5-4-17(26)24-16)10-13-8-23-28-12-13/h1-3,8,11-12H,4-7,9-10H2,(H,22,27) |
| InChIKey | RUOCZSNGGWYDPP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |