C17H20F3N7O2 — CID 156588626
2-[5-methyl-4-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-2,3-dihydro-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 156588626) has the molecular formula C17H20F3N7O2 and a molecular weight of 411.39 g/mol. Its IUPAC name is 2-[5-methyl-4-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-2,3-dihydro-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-2,3-dihydro-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 156588626 |
| Molecular Formula | C17H20F3N7O2 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[5-methyl-4-[4-(2,2,2-trifluoroethyl)piperazine-1-carbonyl]pyrazol-1-yl]-2,3-dihydro-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCN(CC(F)(F)F)CC2)cnn1C1NC(=O)c2cccn2N1 |
| InChI | InChI=1S/C17H20F3N7O2/c1-11-12(15(29)25-7-5-24(6-8-25)10-17(18,19)20)9-21-27(11)16-22-14(28)13-3-2-4-26(13)23-16/h2-4,9,16,23H,5-8,10H2,1H3,(H,22,28) |
| InChIKey | HAXUNQMDYFYKHM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |