C10H12ClN3 — CID 156592018
2-chloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine (PubChem CID 156592018) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-chloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 2-chloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 156592018 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-chloro-7-(2-methylpropyl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC(C)Cn1ccc2cnc(Cl)nc21 |
| InChI | InChI=1S/C10H12ClN3/c1-7(2)6-14-4-3-8-5-12-10(11)13-9(8)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | UNHZRWUCINQBDH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |