About N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 12662864) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 12662864 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C7H8N4/c1-8-6-5-2-3-9-7(5)11-4-10-6/h2-4H,1H3,(H2,8,9,10,11) |
| InChIKey | AXWBJJJQRJBTMI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 12662864) is N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is CNc1ncnc2[nH]ccc12.
What is the InChIKey of N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is AXWBJJJQRJBTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-8-6-5-2-3-9-7(5)11-4-10-6/h2-4H,1H3,(H2,8,9,10,11).
What are the key properties of N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 148.17 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 12662864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).