C23H25N5O4S — CID 156593208
(Z)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-thiophen-2-ylpyrazol-5-yl]prop-2-enamide (PubChem CID 156593208) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-thiophen-2-ylpyrazol-5-yl]prop-2-enamide.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-thiophen-2-ylpyrazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156593208 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-thiophen-2-ylpyrazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)Nc2cc(-c3cccs3)nn2C2NC(=O)CC(C)N2)cc1OC |
| InChI | InChI=1S/C23H25N5O4S/c1-14-11-22(30)26-23(24-14)28-20(13-16(27-28)19-5-4-10-33-19)25-21(29)9-7-15-6-8-17(31-2)18(12-15)32-3/h4-10,12-14,23-24H,11H2,1-3H3,(H,25,29)(H,26,30)/b9-7- |
| InChIKey | IYSXGJLKKHECTG-CLFYSBASSA-N |
| XLogP | 3.23 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|