C24H25N3O5S — CID 156593317
prop-2-enyl 2-butylsulfanyl-5-(4-methoxycarbonylphenyl)-7-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 156593317) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is prop-2-enyl 2-butylsulfanyl-5-(4-methoxycarbonylphenyl)-7-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-butylsulfanyl-5-(4-methoxycarbonylphenyl)-7-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 156593317 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | prop-2-enyl 2-butylsulfanyl-5-(4-methoxycarbonylphenyl)-7-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc2nc(SCCCC)[nH]c(=O)c2c1-c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-5-7-13-33-24-26-20-19(21(28)27-24)18(15-8-10-16(11-9-15)22(29)31-4)17(14(3)25-20)23(30)32-12-6-2/h6,8-11H,2,5,7,12-13H2,1,3-4H3,(H,25,26,27,28) |
| InChIKey | JZORUJHEURNMBF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|