About 7-fluoro-5-iodo-2,7-dihydroindazol-3-one
7-fluoro-5-iodo-2,7-dihydroindazol-3-one (PubChem CID 156595252) has the molecular formula C7H4FIN2O
and a molecular weight of 278.02 g/mol. Its IUPAC name is 7-fluoro-5-iodo-2,7-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 7-fluoro-5-iodo-2,7-dihydroindazol-3-one |
| PubChem CID | 156595252 |
| Molecular Formula | C7H4FIN2O |
| Molecular Weight | 278.02 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 7-fluoro-5-iodo-2,7-dihydroindazol-3-one |
| SMILES | O=C1NN=C2C1=CC(I)=CC2F |
| InChI | InChI=1S/C7H4FIN2O/c8-5-2-3(9)1-4-6(5)10-11-7(4)12/h1-2,5H,(H,11,12) |
| InChIKey | WYDZBTUZTHTZGT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.02 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-5-iodo-2,7-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5-iodo-2,7-dihydroindazol-3-one?
The IUPAC name of 7-fluoro-5-iodo-2,7-dihydroindazol-3-one (CID 156595252) is 7-fluoro-5-iodo-2,7-dihydroindazol-3-one.
What is the SMILES notation for 7-fluoro-5-iodo-2,7-dihydroindazol-3-one?
The canonical SMILES for 7-fluoro-5-iodo-2,7-dihydroindazol-3-one is O=C1NN=C2C1=CC(I)=CC2F.
What is the InChIKey of 7-fluoro-5-iodo-2,7-dihydroindazol-3-one?
The InChIKey is WYDZBTUZTHTZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FIN2O/c8-5-2-3(9)1-4-6(5)10-11-7(4)12/h1-2,5H,(H,11,12).
What are the key properties of 7-fluoro-5-iodo-2,7-dihydroindazol-3-one?
7-fluoro-5-iodo-2,7-dihydroindazol-3-one has a molecular weight of 278.02 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5-iodo-2,7-dihydroindazol-3-one is sourced from PubChem (CID 156595252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).