About 7-amino-4-fluoro-2,7-dihydroindazol-3-one
7-amino-4-fluoro-2,7-dihydroindazol-3-one (PubChem CID 74523643) has the molecular formula C7H6FN3O
and a molecular weight of 167.14 g/mol. Its IUPAC name is 7-amino-4-fluoro-2,7-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 7-amino-4-fluoro-2,7-dihydroindazol-3-one |
| PubChem CID | 74523643 |
| Molecular Formula | C7H6FN3O |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 7-amino-4-fluoro-2,7-dihydroindazol-3-one |
| SMILES | NC1C=CC(F)=C2C(=O)NN=C21 |
| InChI | InChI=1S/C7H6FN3O/c8-3-1-2-4(9)6-5(3)7(12)11-10-6/h1-2,4H,9H2,(H,11,12) |
| InChIKey | LWAGMDDKRWLHKJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4-fluoro-2,7-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-fluoro-2,7-dihydroindazol-3-one?
The IUPAC name of 7-amino-4-fluoro-2,7-dihydroindazol-3-one (CID 74523643) is 7-amino-4-fluoro-2,7-dihydroindazol-3-one.
What is the SMILES notation for 7-amino-4-fluoro-2,7-dihydroindazol-3-one?
The canonical SMILES for 7-amino-4-fluoro-2,7-dihydroindazol-3-one is NC1C=CC(F)=C2C(=O)NN=C21.
What is the InChIKey of 7-amino-4-fluoro-2,7-dihydroindazol-3-one?
The InChIKey is LWAGMDDKRWLHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN3O/c8-3-1-2-4(9)6-5(3)7(12)11-10-6/h1-2,4H,9H2,(H,11,12).
What are the key properties of 7-amino-4-fluoro-2,7-dihydroindazol-3-one?
7-amino-4-fluoro-2,7-dihydroindazol-3-one has a molecular weight of 167.14 g/mol, XLogP of -0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-fluoro-2,7-dihydroindazol-3-one is sourced from PubChem (CID 74523643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).